C25H38N8O9 — CID 19952423
2-[[2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid (PubChem CID 19952423) has the molecular formula C25H38N8O9 and a molecular weight of 594.63 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 19952423 |
| Molecular Formula | C25H38N8O9 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 2-[[2-[[5-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-oxopentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
| SMILES | NC(=O)CCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H38N8O9/c26-15(12-13-3-5-14(34)6-4-13)21(38)31-17(7-9-19(27)35)23(40)32-16(2-1-11-30-25(28)29)22(39)33-18(24(41)42)8-10-20(36)37/h3-6,15-18,34H,1-2,7-12,26H2,(H2,27,35)(H,31,38)(H,32,40)(H,33,39)(H,36,37)(H,41,42)(H4,28,29,30) |
| InChIKey | LUGZPULHPRBOQH-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 315.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|