C26H42N8O8 — CID 19950520
6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 19950520) has the molecular formula C26H42N8O8 and a molecular weight of 594.67 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19950520 |
| Molecular Formula | C26H42N8O8 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | 6-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C26H42N8O8/c27-12-2-1-4-20(25(41)42)34-24(40)19(10-11-21(36)37)33-23(39)18(5-3-13-31-26(29)30)32-22(38)17(28)14-15-6-8-16(35)9-7-15/h6-9,17-20,35H,1-5,10-14,27-28H2,(H,32,38)(H,33,39)(H,34,40)(H,36,37)(H,41,42)(H4,29,30,31) |
| InChIKey | XTADYHWWODFMQC-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 298.57 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|