C24H40N8O6S — CID 18255255
6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 18255255) has the molecular formula C24H40N8O6S and a molecular weight of 568.70 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18255255 |
| Molecular Formula | C24H40N8O6S |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C24H40N8O6S/c25-10-2-1-4-18(23(37)38)31-22(36)19(12-14-6-8-15(33)9-7-14)32-21(35)17(5-3-11-29-24(27)28)30-20(34)16(26)13-39/h6-9,16-19,33,39H,1-5,10-13,25-26H2,(H,30,34)(H,31,36)(H,32,35)(H,37,38)(H4,27,28,29) |
| InChIKey | XJCCXIIEXACHML-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 261.27 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|