C24H40N8O7 — CID 18303023
2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18303023) has the molecular formula C24H40N8O7 and a molecular weight of 552.63 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18303023 |
| Molecular Formula | C24H40N8O7 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H40N8O7/c25-10-2-1-4-16(26)20(35)30-17(5-3-11-29-24(27)28)21(36)32-19(13-33)22(37)31-18(23(38)39)12-14-6-8-15(34)9-7-14/h6-9,16-19,33-34H,1-5,10-13,25-26H2,(H,30,35)(H,31,37)(H,32,36)(H,38,39)(H4,27,28,29) |
| InChIKey | QVJXJSKLIAQRLH-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 281.50 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|