C22H37N7O5 — CID 175935756
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-4-(4-hydroxyphenyl)butanoic acid (PubChem CID 175935756) has the molecular formula C22H37N7O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-4-(4-hydroxyphenyl)butanoic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-4-(4-hydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 175935756 |
| Molecular Formula | C22H37N7O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-4-(4-hydroxyphenyl)butanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CCc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H37N7O5/c23-12-2-1-5-17(28-19(31)16(24)4-3-13-27-22(25)26)20(32)29-18(21(33)34)11-8-14-6-9-15(30)10-7-14/h6-7,9-10,16-18,30H,1-5,8,11-13,23-24H2,(H,28,31)(H,29,32)(H,33,34)(H4,25,26,27)/t16-,17-,18-/m0/s1 |
| InChIKey | LXOQOTITKARDKJ-BZSNNMDCSA-N |
| XLogP | -1.11 |
| TPSA | 232.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|