C26H43N9O7 — CID 18245025
2-[[5-amino-2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18245025) has the molecular formula C26H43N9O7 and a molecular weight of 593.69 g/mol. Its IUPAC name is 2-[[5-amino-2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[5-amino-2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18245025 |
| Molecular Formula | C26H43N9O7 |
| Molecular Weight | 593.69 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | 2-[[5-amino-2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C26H43N9O7/c27-12-2-1-5-18(33-22(38)17(28)4-3-13-32-26(30)31)23(39)34-19(10-11-21(29)37)24(40)35-20(25(41)42)14-15-6-8-16(36)9-7-15/h6-9,17-20,36H,1-5,10-14,27-28H2,(H2,29,37)(H,33,38)(H,34,39)(H,35,40)(H,41,42)(H4,30,31,32) |
| InChIKey | SPFDJZTVPRAXFX-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 304.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.69 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|