C29H40N8O7 — CID 22701247
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 22701247) has the molecular formula C29H40N8O7 and a molecular weight of 612.69 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 22701247 |
| Molecular Formula | C29H40N8O7 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,5-diamino-5-oxopentanoyl)amino]pentanoyl]amino]-3-phenylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C29H40N8O7/c30-20(12-13-24(31)39)25(40)35-21(7-4-14-34-29(32)33)26(41)36-22(15-17-5-2-1-3-6-17)27(42)37-23(28(43)44)16-18-8-10-19(38)11-9-18/h1-3,5-6,8-11,20-23,38H,4,7,12-16,30H2,(H2,31,39)(H,35,40)(H,36,41)(H,37,42)(H,43,44)(H4,32,33,34) |
| InChIKey | FNGUBYGWFWVXLK-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|