C29H40N8O6 — CID 18245810
2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18245810) has the molecular formula C29H40N8O6 and a molecular weight of 596.69 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18245810 |
| Molecular Formula | C29H40N8O6 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H40N8O6/c30-20(12-7-15-34-29(32)33)25(39)36-22(16-18-8-3-1-4-9-18)27(41)35-21(13-14-24(31)38)26(40)37-23(28(42)43)17-19-10-5-2-6-11-19/h1-6,8-11,20-23H,7,12-17,30H2,(H2,31,38)(H,35,41)(H,36,39)(H,37,40)(H,42,43)(H4,32,33,34) |
| InChIKey | REUFPCBCIXMWNO-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|