C24H37N9O7 — CID 18245799
4-amino-2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid (PubChem CID 18245799) has the molecular formula C24H37N9O7 and a molecular weight of 563.62 g/mol. Its IUPAC name is 4-amino-2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18245799 |
| Molecular Formula | C24H37N9O7 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | 4-amino-2-[[5-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C24H37N9O7/c25-14(7-4-10-30-24(28)29)20(36)32-16(11-13-5-2-1-3-6-13)22(38)31-15(8-9-18(26)34)21(37)33-17(23(39)40)12-19(27)35/h1-3,5-6,14-17H,4,7-12,25H2,(H2,26,34)(H2,27,35)(H,31,38)(H,32,36)(H,33,37)(H,39,40)(H4,28,29,30) |
| InChIKey | OCXOYXKRTWBNOP-UHFFFAOYSA-N |
| XLogP | -3.71 |
| TPSA | 301.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|