C25H41N9O6 — CID 18245729
6-amino-2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid (PubChem CID 18245729) has the molecular formula C25H41N9O6 and a molecular weight of 563.66 g/mol. Its IUPAC name is 6-amino-2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18245729 |
| Molecular Formula | C25H41N9O6 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | 6-amino-2-[[4-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-4-oxobutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CC(N)=O)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H41N9O6/c26-11-5-4-10-17(24(39)40)32-23(38)19(14-20(28)35)34-22(37)18(13-15-7-2-1-3-8-15)33-21(36)16(27)9-6-12-31-25(29)30/h1-3,7-8,16-19H,4-6,9-14,26-27H2,(H2,28,35)(H,32,38)(H,33,36)(H,34,37)(H,39,40)(H4,29,30,31) |
| InChIKey | PCGXQMRERSFBLY-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 284.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|