C30H44N8O5 — CID 18307711
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18307711) has the molecular formula C30H44N8O5 and a molecular weight of 596.73 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18307711 |
| Molecular Formula | C30H44N8O5 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C30H44N8O5/c31-16-8-7-14-22(32)26(39)37-24(18-20-10-3-1-4-11-20)28(41)38-25(19-21-12-5-2-6-13-21)27(40)36-23(29(42)43)15-9-17-35-30(33)34/h1-6,10-13,22-25H,7-9,14-19,31-32H2,(H,36,40)(H,37,39)(H,38,41)(H,42,43)(H4,33,34,35) |
| InChIKey | FHGYZUQKOZJCIL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|