C24H40N8O5S — CID 18259135
2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18259135) has the molecular formula C24H40N8O5S and a molecular weight of 552.70 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18259135 |
| Molecular Formula | C24H40N8O5S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CS)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H40N8O5S/c25-11-5-4-9-17(30-20(33)16(26)14-38)21(34)32-19(13-15-7-2-1-3-8-15)22(35)31-18(23(36)37)10-6-12-29-24(27)28/h1-3,7-8,16-19,38H,4-6,9-14,25-26H2,(H,30,33)(H,31,35)(H,32,34)(H,36,37)(H4,27,28,29) |
| InChIKey | ZJGXDMSRTUAMOD-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|