C27H47N11O5 — CID 18244924
2-[[2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18244924) has the molecular formula C27H47N11O5 and a molecular weight of 605.75 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18244924 |
| Molecular Formula | C27H47N11O5 |
| Molecular Weight | 605.75 g/mol |
| Exact Mass | 605.38 |
| IUPAC Name | 2-[[2-[[6-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H47N11O5/c28-13-5-4-11-19(36-22(39)18(29)10-6-14-34-26(30)31)23(40)37-20(12-7-15-35-27(32)33)24(41)38-21(25(42)43)16-17-8-2-1-3-9-17/h1-3,8-9,18-21H,4-7,10-16,28-29H2,(H,36,39)(H,37,40)(H,38,41)(H,42,43)(H4,30,31,34)(H4,32,33,35) |
| InChIKey | UEJKVDGVZNVYPX-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 305.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.75 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|