C27H47N9O5 — CID 18307481
6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid (PubChem CID 18307481) has the molecular formula C27H47N9O5 and a molecular weight of 577.73 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18307481 |
| Molecular Formula | C27H47N9O5 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.37 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C27H47N9O5/c28-14-6-4-11-19(30)23(37)36-22(17-18-9-2-1-3-10-18)25(39)34-20(13-8-16-33-27(31)32)24(38)35-21(26(40)41)12-5-7-15-29/h1-3,9-10,19-22H,4-8,11-17,28-30H2,(H,34,39)(H,35,38)(H,36,37)(H,40,41)(H4,31,32,33) |
| InChIKey | GQCFZPLOVFVYOT-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 267.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|