C25H41N11O6 — CID 18245701
4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid (PubChem CID 18245701) has the molecular formula C25H41N11O6 and a molecular weight of 591.67 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18245701 |
| Molecular Formula | C25H41N11O6 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.32 |
| IUPAC Name | 4-amino-2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H41N11O6/c26-15(8-4-10-32-24(28)29)20(38)35-17(12-14-6-2-1-3-7-14)22(40)34-16(9-5-11-33-25(30)31)21(39)36-18(23(41)42)13-19(27)37/h1-3,6-7,15-18H,4-5,8-13,26H2,(H2,27,37)(H,34,40)(H,35,38)(H,36,39)(H,41,42)(H4,28,29,32)(H4,30,31,33) |
| InChIKey | AFWCFHGLWXZFIK-UHFFFAOYSA-N |
| XLogP | -3.92 |
| TPSA | 322.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|