C28H37N7O7 — CID 56959877
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid (PubChem CID 56959877) has the molecular formula C28H37N7O7 and a molecular weight of 583.65 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 56959877 |
| Molecular Formula | C28H37N7O7 |
| Molecular Weight | 583.65 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H37N7O7/c29-19(14-17-8-3-1-4-9-17)24(38)33-20(12-7-13-32-28(30)31)25(39)34-21(15-18-10-5-2-6-11-18)26(40)35-22(27(41)42)16-23(36)37/h1-6,8-11,19-22H,7,12-16,29H2,(H,33,38)(H,34,39)(H,35,40)(H,36,37)(H,41,42)(H4,30,31,32)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | QQFLXCXAQLWGHV-CMOCDZPBSA-N |
| XLogP | -1.13 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.65 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|