C19H28N6O6 — CID 18219392
3-amino-4-[[1-[(1-carboxy-2-phenylethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18219392) has the molecular formula C19H28N6O6 and a molecular weight of 436.47 g/mol. Its IUPAC name is 3-amino-4-[[1-[(1-carboxy-2-phenylethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[(1-carboxy-2-phenylethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18219392 |
| Molecular Formula | C19H28N6O6 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-amino-4-[[1-[(1-carboxy-2-phenylethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H28N6O6/c20-12(10-15(26)27)16(28)24-13(7-4-8-23-19(21)22)17(29)25-14(18(30)31)9-11-5-2-1-3-6-11/h1-3,5-6,12-14H,4,7-10,20H2,(H,24,28)(H,25,29)(H,26,27)(H,30,31)(H4,21,22,23) |
| InChIKey | MRQQMVZUHXUPEV-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 223.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|