C23H33N7O10 — CID 18246983
3-amino-4-[[1-[[3-carboxy-1-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18246983) has the molecular formula C23H33N7O10 and a molecular weight of 567.56 g/mol. Its IUPAC name is 3-amino-4-[[1-[[3-carboxy-1-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[[3-carboxy-1-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18246983 |
| Molecular Formula | C23H33N7O10 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 3-amino-4-[[1-[[3-carboxy-1-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(N)CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C23H33N7O10/c24-13(9-17(32)33)19(36)28-14(2-1-7-27-23(25)26)20(37)29-15(10-18(34)35)21(38)30-16(22(39)40)8-11-3-5-12(31)6-4-11/h3-6,13-16,31H,1-2,7-10,24H2,(H,28,36)(H,29,37)(H,30,38)(H,32,33)(H,34,35)(H,39,40)(H4,25,26,27) |
| InChIKey | YFIRKJYIYNLOGY-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 309.85 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|