C22H34N8O7S — CID 22652574
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 22652574) has the molecular formula C22H34N8O7S and a molecular weight of 554.63 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 22652574 |
| Molecular Formula | C22H34N8O7S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CS)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H34N8O7S/c23-13(9-17(24)32)18(33)28-14(2-1-7-27-22(25)26)19(34)30-16(10-38)20(35)29-15(21(36)37)8-11-3-5-12(31)6-4-11/h3-6,13-16,31,38H,1-2,7-10,23H2,(H2,24,32)(H,28,33)(H,29,35)(H,30,34)(H,36,37)(H4,25,26,27) |
| InChIKey | JICAKNCVIZLSLM-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|