C25H41N9O7 — CID 22652846
6-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 22652846) has the molecular formula C25H41N9O7 and a molecular weight of 579.66 g/mol. Its IUPAC name is 6-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22652846 |
| Molecular Formula | C25H41N9O7 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | 6-amino-2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C25H41N9O7/c26-10-2-1-4-18(24(40)41)33-23(39)19(12-14-6-8-15(35)9-7-14)34-22(38)17(5-3-11-31-25(29)30)32-21(37)16(27)13-20(28)36/h6-9,16-19,35H,1-5,10-13,26-27H2,(H2,28,36)(H,32,37)(H,33,39)(H,34,38)(H,40,41)(H4,29,30,31) |
| InChIKey | ZIEKNBKRZOWCAA-UHFFFAOYSA-N |
| XLogP | -3.14 |
| TPSA | 304.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|