C21H35N7O5 — CID 18231874
6-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid (PubChem CID 18231874) has the molecular formula C21H35N7O5 and a molecular weight of 465.56 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18231874 |
| Molecular Formula | C21H35N7O5 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 6-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C21H35N7O5/c22-10-2-1-4-17(20(32)33)28-19(31)16(5-3-11-26-21(24)25)27-18(30)15(23)12-13-6-8-14(29)9-7-13/h6-9,15-17,29H,1-5,10-12,22-23H2,(H,27,30)(H,28,31)(H,32,33)(H4,24,25,26) |
| InChIKey | GFZQWWDXJVGEMW-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 232.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|