C18H28N6O6 — CID 18232125
2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18232125) has the molecular formula C18H28N6O6 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18232125 |
| Molecular Formula | C18H28N6O6 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CO)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C18H28N6O6/c19-12(8-10-3-5-11(26)6-4-10)15(27)24-14(9-25)16(28)23-13(17(29)30)2-1-7-22-18(20)21/h3-6,12-14,25-26H,1-2,7-9,19H2,(H,23,28)(H,24,27)(H,29,30)(H4,20,21,22) |
| InChIKey | RWOKVQUCENPXGE-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 226.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|