C23H35N9O8 — CID 19950847
2-[[4-amino-2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19950847) has the molecular formula C23H35N9O8 and a molecular weight of 565.59 g/mol. Its IUPAC name is 2-[[4-amino-2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[4-amino-2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19950847 |
| Molecular Formula | C23H35N9O8 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 2-[[4-amino-2-[[4-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-oxobutanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H35N9O8/c24-13(8-11-3-5-12(33)6-4-11)19(36)31-15(9-17(25)34)21(38)32-16(10-18(26)35)20(37)30-14(22(39)40)2-1-7-29-23(27)28/h3-6,13-16,33H,1-2,7-10,24H2,(H2,25,34)(H2,26,35)(H,30,37)(H,31,36)(H,32,38)(H,39,40)(H4,27,28,29) |
| InChIKey | JBLXVCMWROOAFM-UHFFFAOYSA-N |
| XLogP | -4.39 |
| TPSA | 321.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|