C24H36N8O9 — CID 19950475
5-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid (PubChem CID 19950475) has the molecular formula C24H36N8O9 and a molecular weight of 580.60 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19950475 |
| Molecular Formula | C24H36N8O9 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 5-amino-2-[[2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)C(CC(=O)O)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C24H36N8O9/c25-14(10-12-3-5-13(33)6-4-12)20(37)30-15(2-1-9-29-24(27)28)21(38)32-17(11-19(35)36)22(39)31-16(23(40)41)7-8-18(26)34/h3-6,14-17,33H,1-2,7-11,25H2,(H2,26,34)(H,30,37)(H,31,39)(H,32,38)(H,35,36)(H,40,41)(H4,27,28,29) |
| InChIKey | KVAYIZRQDZHLBB-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 315.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|