C25H40N8O7S — CID 19950541
2-[[5-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 19950541) has the molecular formula C25H40N8O7S and a molecular weight of 596.71 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 19950541 |
| Molecular Formula | C25H40N8O7S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | 2-[[5-amino-2-[[2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CCC(N)=O)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C25H40N8O7S/c1-41-12-10-19(24(39)40)33-23(38)18(8-9-20(27)35)32-22(37)17(3-2-11-30-25(28)29)31-21(36)16(26)13-14-4-6-15(34)7-5-14/h4-7,16-19,34H,2-3,8-13,26H2,1H3,(H2,27,35)(H,31,36)(H,32,37)(H,33,38)(H,39,40)(H4,28,29,30) |
| InChIKey | YLSDGDFUEVYQMT-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|