C26H44N8O6S — CID 19954615
2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19954615) has the molecular formula C26H44N8O6S and a molecular weight of 596.76 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19954615 |
| Molecular Formula | C26H44N8O6S |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCCN)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C26H44N8O6S/c1-41-14-11-20(24(38)34-21(25(39)40)6-4-13-31-26(29)30)33-23(37)19(5-2-3-12-27)32-22(36)18(28)15-16-7-9-17(35)10-8-16/h7-10,18-21,35H,2-6,11-15,27-28H2,1H3,(H,32,36)(H,33,37)(H,34,38)(H,39,40)(H4,29,30,31) |
| InChIKey | ZQFSYPANUXXYBN-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 261.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|