C25H39N9O8 — CID 18479521
2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18479521) has the molecular formula C25H39N9O8 and a molecular weight of 593.64 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18479521 |
| Molecular Formula | C25H39N9O8 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | 2-[[2-[[5-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-5-oxopentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H39N9O8/c26-15(7-9-19(27)36)21(38)32-16(8-10-20(28)37)22(39)34-18(12-13-3-5-14(35)6-4-13)23(40)33-17(24(41)42)2-1-11-31-25(29)30/h3-6,15-18,35H,1-2,7-12,26H2,(H2,27,36)(H2,28,37)(H,32,38)(H,33,40)(H,34,39)(H,41,42)(H4,29,30,31) |
| InChIKey | FAGJYZKBUSKKHO-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 321.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|