C22H34N8O7 — CID 18479919
5-(diaminomethylideneamino)-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanoic acid (PubChem CID 18479919) has the molecular formula C22H34N8O7 and a molecular weight of 522.56 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 18479919 |
| Molecular Formula | C22H34N8O7 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]pentanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NCC(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H34N8O7/c23-14(7-8-17(24)32)19(34)28-11-18(33)29-16(10-12-3-5-13(31)6-4-12)20(35)30-15(21(36)37)2-1-9-27-22(25)26/h3-6,14-16,31H,1-2,7-11,23H2,(H2,24,32)(H,28,34)(H,29,33)(H,30,35)(H,36,37)(H4,25,26,27) |
| InChIKey | PVRVBWQCEFKBKJ-UHFFFAOYSA-N |
| XLogP | -3.25 |
| TPSA | 278.34 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|