C25H37N7O10 — CID 22699875
4-amino-5-[[1-[[4-carboxy-1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxobutan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 22699875) has the molecular formula C25H37N7O10 and a molecular weight of 595.61 g/mol. Its IUPAC name is 4-amino-5-[[1-[[4-carboxy-1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxobutan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[4-carboxy-1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxobutan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22699875 |
| Molecular Formula | C25H37N7O10 |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 4-amino-5-[[1-[[4-carboxy-1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxobutan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H37N7O10/c26-15(7-9-19(34)35)21(38)32-18(12-13-3-5-14(33)6-4-13)23(40)30-16(8-10-20(36)37)22(39)31-17(24(41)42)2-1-11-29-25(27)28/h3-6,15-18,33H,1-2,7-12,26H2,(H,30,40)(H,31,39)(H,32,38)(H,34,35)(H,36,37)(H,41,42)(H4,27,28,29) |
| InChIKey | LOSRHQIANMPUMI-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 309.85 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|