C23H35N7O9 — CID 18242882
4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18242882) has the molecular formula C23H35N7O9 and a molecular weight of 553.57 g/mol. Its IUPAC name is 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18242882 |
| Molecular Formula | C23H35N7O9 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 4-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C23H35N7O9/c24-14(2-1-9-27-23(25)26)19(35)28-15(7-8-18(33)34)20(36)29-16(10-12-3-5-13(32)6-4-12)21(37)30-17(11-31)22(38)39/h3-6,14-17,31-32H,1-2,7-11,24H2,(H,28,35)(H,29,36)(H,30,37)(H,33,34)(H,38,39)(H4,25,26,27) |
| InChIKey | BAIOZDTUSDBBMG-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 292.78 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|