C29H39N7O8 — CID 22700033
4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 22700033) has the molecular formula C29H39N7O8 and a molecular weight of 613.67 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22700033 |
| Molecular Formula | C29H39N7O8 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | 4-amino-5-[[1-[[1-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H39N7O8/c30-20(12-13-24(38)39)25(40)35-22(16-18-8-10-19(37)11-9-18)27(42)36-23(15-17-5-2-1-3-6-17)26(41)34-21(28(43)44)7-4-14-33-29(31)32/h1-3,5-6,8-11,20-23,37H,4,7,12-16,30H2,(H,34,41)(H,35,40)(H,36,42)(H,38,39)(H,43,44)(H4,31,32,33) |
| InChIKey | UNKVSEPAKBTWKZ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|