C26H42N10O7 — CID 18245704
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid (PubChem CID 18245704) has the molecular formula C26H42N10O7 and a molecular weight of 606.69 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18245704 |
| Molecular Formula | C26H42N10O7 |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H42N10O7/c27-16(8-4-12-32-25(28)29)21(39)36-19(14-15-6-2-1-3-7-15)23(41)34-17(9-5-13-33-26(30)31)22(40)35-18(24(42)43)10-11-20(37)38/h1-3,6-7,16-19H,4-5,8-14,27H2,(H,34,41)(H,35,40)(H,36,39)(H,37,38)(H,42,43)(H4,28,29,32)(H4,30,31,33) |
| InChIKey | VCKMNYYRAZTBKJ-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 316.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|