C23H35N7O7 — CID 18237838
4-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid (PubChem CID 18237838) has the molecular formula C23H35N7O7 and a molecular weight of 521.58 g/mol. Its IUPAC name is 4-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18237838 |
| Molecular Formula | C23H35N7O7 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | 4-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
| SMILES | CC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H35N7O7/c1-13(24)19(33)30-17(12-14-6-3-2-4-7-14)21(35)28-15(9-10-18(31)32)20(34)29-16(22(36)37)8-5-11-27-23(25)26/h2-4,6-7,13,15-17H,5,8-12,24H2,1H3,(H,28,35)(H,29,34)(H,30,33)(H,31,32)(H,36,37)(H4,25,26,27) |
| InChIKey | DYOLQTLVURKIMM-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|