C14H26N6O6 — CID 145453572
(4S)-4-[[(2S)-2-aminopropanoyl]amino]-5-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid (PubChem CID 145453572) has the molecular formula C14H26N6O6 and a molecular weight of 374.40 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-aminopropanoyl]amino]-5-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-aminopropanoyl]amino]-5-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 145453572 |
| Molecular Formula | C14H26N6O6 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (4S)-4-[[(2S)-2-aminopropanoyl]amino]-5-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C14H26N6O6/c1-7(15)11(23)19-8(4-5-10(21)22)12(24)20-9(13(25)26)3-2-6-18-14(16)17/h7-9H,2-6,15H2,1H3,(H,19,23)(H,20,24)(H,21,22)(H,25,26)(H4,16,17,18)/t7-,8-,9-/m0/s1 |
| InChIKey | NWVVKQZOVSTDBQ-CIUDSAMLSA-N |
| XLogP | -2.69 |
| TPSA | 223.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|