C18H38N8O6 — CID 158215657
5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-[[5-(diaminomethylideneamino)-2-methylpentanoyl]amino]-5-oxopentanoic acid;molecular hydrogen (PubChem CID 158215657) has the molecular formula C18H38N8O6 and a molecular weight of 462.55 g/mol. Its IUPAC name is 5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-[[5-(diaminomethylideneamino)-2-methylpentanoyl]amino]-5-oxopentanoic acid;molecular hydrogen.
| Compound Name | 5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-[[5-(diaminomethylideneamino)-2-methylpentanoyl]amino]-5-oxopentanoic acid;molecular hydrogen |
|---|---|
| PubChem CID | 158215657 |
| Molecular Formula | C18H38N8O6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-4-[[5-(diaminomethylideneamino)-2-methylpentanoyl]amino]-5-oxopentanoic acid;molecular hydrogen |
| SMILES | CC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O.[H][H].[H][H] |
| InChI | InChI=1S/C18H34N8O6.2H2/c1-10(4-2-8-23-17(19)20)14(29)25-11(6-7-13(27)28)15(30)26-12(16(31)32)5-3-9-24-18(21)22;;/h10-12H,2-9H2,1H3,(H,25,29)(H,26,30)(H,27,28)(H,31,32)(H4,19,20,23)(H4,21,22,24);2*1H |
| InChIKey | GCPNPMRRSZYUSC-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 261.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|