C17H32N6O6 — CID 145456126
(4S)-4-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-5-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid (PubChem CID 145456126) has the molecular formula C17H32N6O6 and a molecular weight of 416.48 g/mol. Its IUPAC name is (4S)-4-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-5-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-5-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 145456126 |
| Molecular Formula | C17H32N6O6 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (4S)-4-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-5-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H32N6O6/c1-3-9(2)13(18)15(27)22-10(6-7-12(24)25)14(26)23-11(16(28)29)5-4-8-21-17(19)20/h9-11,13H,3-8,18H2,1-2H3,(H,22,27)(H,23,26)(H,24,25)(H,28,29)(H4,19,20,21)/t9-,10-,11-,13-/m0/s1 |
| InChIKey | JDAWAWXGAUZPNJ-ZPFDUUQYSA-N |
| XLogP | -1.67 |
| TPSA | 223.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|