C19H35N7O8 — CID 18501077
3-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[(1-carboxy-2-hydroxyethyl)amino]-4-oxobutanoic acid (PubChem CID 18501077) has the molecular formula C19H35N7O8 and a molecular weight of 489.53 g/mol. Its IUPAC name is 3-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[(1-carboxy-2-hydroxyethyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[(1-carboxy-2-hydroxyethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18501077 |
| Molecular Formula | C19H35N7O8 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 3-[[2-[(2-amino-3-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-[(1-carboxy-2-hydroxyethyl)amino]-4-oxobutanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C19H35N7O8/c1-3-9(2)14(20)17(32)24-10(5-4-6-23-19(21)22)15(30)25-11(7-13(28)29)16(31)26-12(8-27)18(33)34/h9-12,14,27H,3-8,20H2,1-2H3,(H,24,32)(H,25,30)(H,26,31)(H,28,29)(H,33,34)(H4,21,22,23) |
| InChIKey | FPRUOAVTYPJPJZ-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|