C19H33N7O10 — CID 18745561
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid (PubChem CID 18745561) has the molecular formula C19H33N7O10 and a molecular weight of 519.51 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18745561 |
| Molecular Formula | C19H33N7O10 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H33N7O10/c1-8(27)14(20)17(34)24-9(3-2-6-23-19(21)22)15(32)26-11(7-13(30)31)16(33)25-10(18(35)36)4-5-12(28)29/h8-11,14,27H,2-7,20H2,1H3,(H,24,34)(H,25,33)(H,26,32)(H,28,29)(H,30,31)(H,35,36)(H4,21,22,23) |
| InChIKey | IGHWWSMYKYSADJ-UHFFFAOYSA-N |
| XLogP | -4.37 |
| TPSA | 309.85 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|