C19H35N7O9 — CID 18747129
4-[(2-amino-3-hydroxybutanoyl)amino]-5-[[1-[(1-carboxy-2-hydroxypropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18747129) has the molecular formula C19H35N7O9 and a molecular weight of 505.53 g/mol. Its IUPAC name is 4-[(2-amino-3-hydroxybutanoyl)amino]-5-[[1-[(1-carboxy-2-hydroxypropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[(2-amino-3-hydroxybutanoyl)amino]-5-[[1-[(1-carboxy-2-hydroxypropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18747129 |
| Molecular Formula | C19H35N7O9 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 4-[(2-amino-3-hydroxybutanoyl)amino]-5-[[1-[(1-carboxy-2-hydroxypropyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C19H35N7O9/c1-8(27)13(20)17(33)25-11(5-6-12(29)30)15(31)24-10(4-3-7-23-19(21)22)16(32)26-14(9(2)28)18(34)35/h8-11,13-14,27-28H,3-7,20H2,1-2H3,(H,24,31)(H,25,33)(H,26,32)(H,29,30)(H,34,35)(H4,21,22,23) |
| InChIKey | TYTOODFQXAJWQS-UHFFFAOYSA-N |
| XLogP | -4.47 |
| TPSA | 292.78 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|