C19H37N7O7S — CID 18749923
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18749923) has the molecular formula C19H37N7O7S and a molecular weight of 507.61 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18749923 |
| Molecular Formula | C19H37N7O7S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CSCCC(NC(=O)C(N)C(C)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C19H37N7O7S/c1-9(27)13(20)17(31)25-12(6-8-34-3)15(29)24-11(5-4-7-23-19(21)22)16(30)26-14(10(2)28)18(32)33/h9-14,27-28H,4-8,20H2,1-3H3,(H,24,29)(H,25,31)(H,26,30)(H,32,33)(H4,21,22,23) |
| InChIKey | GDLSHXOALJZIAH-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|