C20H40N10O7 — CID 19940478
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 19940478) has the molecular formula C20H40N10O7 and a molecular weight of 532.60 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 19940478 |
| Molecular Formula | C20H40N10O7 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O)C(C)O |
| InChI | InChI=1S/C20H40N10O7/c1-9(31)13(21)16(34)30-14(10(2)32)17(35)28-11(5-3-7-26-19(22)23)15(33)29-12(18(36)37)6-4-8-27-20(24)25/h9-14,31-32H,3-8,21H2,1-2H3,(H,28,35)(H,29,33)(H,30,34)(H,36,37)(H4,22,23,26)(H4,24,25,27) |
| InChIKey | UCRWLYSKOXVQIN-UHFFFAOYSA-N |
| XLogP | -5.28 |
| TPSA | 319.88 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | -5.28 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|