C21H42N8O6 — CID 18749868
2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18749868) has the molecular formula C21H42N8O6 and a molecular weight of 502.62 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18749868 |
| Molecular Formula | C21H42N8O6 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)C(C)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H42N8O6/c1-11(2)16(19(33)28-14(20(34)35)8-6-10-26-21(24)25)29-17(31)13(7-4-5-9-22)27-18(32)15(23)12(3)30/h11-16,30H,4-10,22-23H2,1-3H3,(H,27,32)(H,28,33)(H,29,31)(H,34,35)(H4,24,25,26) |
| InChIKey | UOOYJHXRYCSFMP-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 261.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|