C20H39N7O6 — CID 19941694
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid (PubChem CID 19941694) has the molecular formula C20H39N7O6 and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19941694 |
| Molecular Formula | C20H39N7O6 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(NC(=O)C(N)C(C)O)C(C)C)C(=O)O |
| InChI | InChI=1S/C20H39N7O6/c1-9(2)14(26-17(30)13(21)11(5)28)18(31)25-12(7-6-8-24-20(22)23)16(29)27-15(10(3)4)19(32)33/h9-15,28H,6-8,21H2,1-5H3,(H,25,31)(H,26,30)(H,27,29)(H,32,33)(H4,22,23,24) |
| InChIKey | LCDFAVFEGMYPSU-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|