C17H33N7O8 — CID 71402585
(2S)-2-[[(2S)-2-[[(2S,3R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 71402585) has the molecular formula C17H33N7O8 and a molecular weight of 463.49 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S,3R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S,3R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 71402585 |
| Molecular Formula | C17H33N7O8 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S,3R)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CO)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C17H33N7O8/c1-7(26)11(18)14(29)24-12(8(2)27)15(30)22-9(4-3-5-21-17(19)20)13(28)23-10(6-25)16(31)32/h7-12,25-27H,3-6,18H2,1-2H3,(H,22,30)(H,23,28)(H,24,29)(H,31,32)(H4,19,20,21)/t7-,8-,9+,10+,11+,12+/m1/s1 |
| InChIKey | KFQQUOMAGMLUHG-HAVMIZHYSA-N |
| XLogP | -5.34 |
| TPSA | 275.71 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | -5.34 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|