C17H32N8O8 — CID 18745797
4-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-4-oxobutanoic acid (PubChem CID 18745797) has the molecular formula C17H32N8O8 and a molecular weight of 476.49 g/mol. Its IUPAC name is 4-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18745797 |
| Molecular Formula | C17H32N8O8 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H32N8O8/c1-7(27)12(19)15(31)23-8(3-2-4-22-17(20)21)13(29)25-10(6-26)14(30)24-9(16(32)33)5-11(18)28/h7-10,12,26-27H,2-6,19H2,1H3,(H2,18,28)(H,23,31)(H,24,30)(H,25,29)(H,32,33)(H4,20,21,22) |
| InChIKey | KQIMOXHSQGWPLE-UHFFFAOYSA-N |
| XLogP | -5.85 |
| TPSA | 298.57 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | -5.85 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|