C20H38N10O8 — CID 18745519
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid (PubChem CID 18745519) has the molecular formula C20H38N10O8 and a molecular weight of 546.59 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18745519 |
| Molecular Formula | C20H38N10O8 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H38N10O8/c1-9(31)14(21)17(36)29-11(5-3-7-27-20(24)25)15(34)28-10(4-2-6-26-19(22)23)16(35)30-12(18(37)38)8-13(32)33/h9-12,14,31H,2-8,21H2,1H3,(H,28,34)(H,29,36)(H,30,35)(H,32,33)(H,37,38)(H4,22,23,26)(H4,24,25,27) |
| InChIKey | ZKCSUDMJRXLMNA-UHFFFAOYSA-N |
| XLogP | -5.18 |
| TPSA | 336.95 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | -5.18 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|