C15H28N6O6 — CID 18232233
2-[[2-[(2-amino-3-methylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid (PubChem CID 18232233) has the molecular formula C15H28N6O6 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-methylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[(2-amino-3-methylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18232233 |
| Molecular Formula | C15H28N6O6 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 2-[[2-[(2-amino-3-methylbutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
| SMILES | CC(C)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H28N6O6/c1-7(2)11(16)13(25)20-8(4-3-5-19-15(17)18)12(24)21-9(14(26)27)6-10(22)23/h7-9,11H,3-6,16H2,1-2H3,(H,20,25)(H,21,24)(H,22,23)(H,26,27)(H4,17,18,19) |
| InChIKey | NMANTMWGQZASQN-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 223.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|