C13H26N6O6 — CID 18224206
2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18224206) has the molecular formula C13H26N6O6 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18224206 |
| Molecular Formula | C13H26N6O6 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C13H26N6O6/c1-6(21)9(14)11(23)18-7(3-2-4-17-13(15)16)10(22)19-8(5-20)12(24)25/h6-9,20-21H,2-5,14H2,1H3,(H,18,23)(H,19,22)(H,24,25)(H4,15,16,17) |
| InChIKey | CEXFELBFVHLYDZ-UHFFFAOYSA-N |
| XLogP | -4.21 |
| TPSA | 226.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|