C12H24N6O5 — CID 25123282
(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 25123282) has the molecular formula C12H24N6O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 25123282 |
| Molecular Formula | C12H24N6O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C12H24N6O5/c1-6(13)9(20)17-7(3-2-4-16-12(14)15)10(21)18-8(5-19)11(22)23/h6-8,19H,2-5,13H2,1H3,(H,17,20)(H,18,21)(H,22,23)(H4,14,15,16)/t6-,7-,8-/m0/s1 |
| InChIKey | TTXMOJWKNRJWQJ-FXQIFTODSA-N |
| XLogP | -3.57 |
| TPSA | 206.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|