C20H39N7O6S2 — CID 22650742
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 22650742) has the molecular formula C20H39N7O6S2 and a molecular weight of 537.71 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22650742 |
| Molecular Formula | C20H39N7O6S2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CCSC)NC(=O)C(NC(=O)C(N)CCCN=C(N)N)C(C)O)C(=O)O |
| InChI | InChI=1S/C20H39N7O6S2/c1-11(28)15(27-16(29)12(21)5-4-8-24-20(22)23)18(31)25-13(6-9-34-2)17(30)26-14(19(32)33)7-10-35-3/h11-15,28H,4-10,21H2,1-3H3,(H,25,31)(H,26,30)(H,27,29)(H,32,33)(H4,22,23,24) |
| InChIKey | QTGCNVUJZDBTJU-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|